C26H25ClN6O2+2 — CID 56843392
4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-pyridin-1-ium-1-ylethyl)aniline (PubChem CID 56843392) has the molecular formula C26H25ClN6O2+2 and a molecular weight of 488.98 g/mol. Its IUPAC name is 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-pyridin-1-ium-1-ylethyl)aniline.
| Compound Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-pyridin-1-ium-1-ylethyl)aniline |
|---|---|
| PubChem CID | 56843392 |
| Molecular Formula | C26H25ClN6O2+2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-bis(2-pyridin-1-ium-1-ylethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(N(CC[n+]3ccccc3)CC[n+]3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H25ClN6O2/c27-25-21-24(33(34)35)11-12-26(25)29-28-22-7-9-23(10-8-22)32(19-17-30-13-3-1-4-14-30)20-18-31-15-5-2-6-16-31/h1-16,21H,17-20H2/q+2/b29-28+ |
| InChIKey | DNDLUKGHJMBXOW-ZQHSETAFSA-N |
| XLogP | 5.45 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|