C24H32ClN5O3 — CID 58321209
1-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]-6-(diethylamino)hexan-2-one (PubChem CID 58321209) has the molecular formula C24H32ClN5O3 and a molecular weight of 474.01 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]-6-(diethylamino)hexan-2-one.
| Compound Name | 1-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]-6-(diethylamino)hexan-2-one |
|---|---|
| PubChem CID | 58321209 |
| Molecular Formula | C24H32ClN5O3 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 1-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]-6-(diethylamino)hexan-2-one |
| SMILES | CCN(CC)CCCCC(=O)CN(CC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C24H32ClN5O3/c1-4-28(5-2)16-8-7-9-22(31)18-29(6-3)20-12-10-19(11-13-20)26-27-24-15-14-21(30(32)33)17-23(24)25/h10-15,17H,4-9,16,18H2,1-3H3/b27-26+ |
| InChIKey | ZPYSORLZIXDZTN-CYYJNZCTSA-N |
| XLogP | 6.57 |
| TPSA | 91.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|