C26H27ClN4O5 — CID 11016688
3-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]-2-methylpropanoic acid (PubChem CID 11016688) has the molecular formula C26H27ClN4O5 and a molecular weight of 510.98 g/mol. Its IUPAC name is 3-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11016688 |
| Molecular Formula | C26H27ClN4O5 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 3-[4-[2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethoxy]phenyl]-2-methylpropanoic acid |
| SMILES | CCN(CCOc1ccc(CC(C)C(=O)O)cc1)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C26H27ClN4O5/c1-3-30(14-15-36-23-11-4-19(5-12-23)16-18(2)26(32)33)21-8-6-20(7-9-21)28-29-25-13-10-22(31(34)35)17-24(25)27/h4-13,17-18H,3,14-16H2,1-2H3,(H,32,33)/b29-28+ |
| InChIKey | NTYBAMZVKJVDGD-ZQHSETAFSA-N |
| XLogP | 6.83 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|