C30H47N5O3S — CID 144922880
1-[2-[2-(4-amino-N-ethyl-3-methylanilino)ethoxy]ethoxy]decan-2-ol;5-amino-3-methylthiophene-2,4-dicarbonitrile (PubChem CID 144922880) has the molecular formula C30H47N5O3S and a molecular weight of 557.81 g/mol. Its IUPAC name is 1-[2-[2-(4-amino-N-ethyl-3-methylanilino)ethoxy]ethoxy]decan-2-ol;5-amino-3-methylthiophene-2,4-dicarbonitrile.
| Compound Name | 1-[2-[2-(4-amino-N-ethyl-3-methylanilino)ethoxy]ethoxy]decan-2-ol;5-amino-3-methylthiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 144922880 |
| Molecular Formula | C30H47N5O3S |
| Molecular Weight | 557.81 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | 1-[2-[2-(4-amino-N-ethyl-3-methylanilino)ethoxy]ethoxy]decan-2-ol;5-amino-3-methylthiophene-2,4-dicarbonitrile |
| SMILES | CCCCCCCCC(O)COCCOCCN(CC)c1ccc(N)c(C)c1.Cc1c(C#N)sc(N)c1C#N |
| InChI | InChI=1S/C23H42N2O3.C7H5N3S/c1-4-6-7-8-9-10-11-22(26)19-28-17-16-27-15-14-25(5-2)21-12-13-23(24)20(3)18-21;1-4-5(2-8)7(10)11-6(4)3-9/h12-13,18,22,26H,4-11,14-17,19,24H2,1-3H3;10H2,1H3 |
| InChIKey | HBVGPJWGWCGPNH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|