C39H64N6O7 — CID 144922869
N-[2-amino-5-[bis[2-(2-hydroxydecoxy)ethyl]amino]phenyl]acetamide;2-amino-5-nitrobenzonitrile (PubChem CID 144922869) has the molecular formula C39H64N6O7 and a molecular weight of 728.98 g/mol. Its IUPAC name is N-[2-amino-5-[bis[2-(2-hydroxydecoxy)ethyl]amino]phenyl]acetamide;2-amino-5-nitrobenzonitrile.
| Compound Name | N-[2-amino-5-[bis[2-(2-hydroxydecoxy)ethyl]amino]phenyl]acetamide;2-amino-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 144922869 |
| Molecular Formula | C39H64N6O7 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.48 |
| IUPAC Name | N-[2-amino-5-[bis[2-(2-hydroxydecoxy)ethyl]amino]phenyl]acetamide;2-amino-5-nitrobenzonitrile |
| SMILES | CCCCCCCCC(O)COCCN(CCOCC(O)CCCCCCCC)c1ccc(N)c(NC(C)=O)c1.N#Cc1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C32H59N3O5.C7H5N3O2/c1-4-6-8-10-12-14-16-29(37)25-39-22-20-35(28-18-19-31(33)32(24-28)34-27(3)36)21-23-40-26-30(38)17-15-13-11-9-7-5-2;8-4-5-3-6(10(11)12)1-2-7(5)9/h18-19,24,29-30,37-38H,4-17,20-23,25-26,33H2,1-3H3,(H,34,36);1-3H,9H2 |
| InChIKey | ILOVRDDAJJYNHV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 210.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|