C21H18F3N7O3 — CID 15476022
N-[5-[bis(2-cyanoethyl)amino]-2-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]phenyl]acetamide (PubChem CID 15476022) has the molecular formula C21H18F3N7O3 and a molecular weight of 473.42 g/mol. Its IUPAC name is N-[5-[bis(2-cyanoethyl)amino]-2-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[bis(2-cyanoethyl)amino]-2-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 15476022 |
| Molecular Formula | C21H18F3N7O3 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[5-[bis(2-cyanoethyl)amino]-2-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N(CCC#N)CCC#N)ccc1/N=N/c1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C21H18F3N7O3/c1-14(32)27-20-13-15(30(10-2-8-25)11-3-9-26)4-7-19(20)29-28-18-6-5-16(31(33)34)12-17(18)21(22,23)24/h4-7,12-13H,2-3,10-11H2,1H3,(H,27,32)/b29-28+ |
| InChIKey | IQHMFADZQKPSAA-ZQHSETAFSA-N |
| XLogP | 5.62 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|