C36H28CaN6O12S2 — CID 136855838
calcium bis(8-[(2-ethyl-5-nitrophenyl)diazenyl]-7-hydroxynaphthalene-2-sulfonate) (PubChem CID 136855838) has the molecular formula C36H28CaN6O12S2 and a molecular weight of 840.86 g/mol. Its IUPAC name is calcium bis(8-[(2-ethyl-5-nitrophenyl)diazenyl]-7-hydroxynaphthalene-2-sulfonate).
| Compound Name | calcium bis(8-[(2-ethyl-5-nitrophenyl)diazenyl]-7-hydroxynaphthalene-2-sulfonate) |
|---|---|
| PubChem CID | 136855838 |
| Molecular Formula | C36H28CaN6O12S2 |
| Molecular Weight | 840.86 g/mol |
| Exact Mass | 840.08 |
| IUPAC Name | calcium bis(8-[(2-ethyl-5-nitrophenyl)diazenyl]-7-hydroxynaphthalene-2-sulfonate) |
| SMILES | CCc1ccc([N+](=O)[O-])cc1/N=N/c1c(O)ccc2ccc(S(=O)(=O)[O-])cc12.CCc1ccc([N+](=O)[O-])cc1/N=N/c1c(O)ccc2ccc(S(=O)(=O)[O-])cc12.[Ca+2] |
| InChI | InChI=1S/2C18H15N3O6S.Ca/c2*1-2-11-3-6-13(21(23)24)9-16(11)19-20-18-15-10-14(28(25,26)27)7-4-12(15)5-8-17(18)22;/h2*3-10,22H,2H2,1H3,(H,25,26,27);/q;;+2/p-2/b2*20-19+; |
| InChIKey | QQBVUUINGJJDRA-FFRZOONGSA-L |
| XLogP | 8.29 |
| TPSA | 290.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.86 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|