C15H12N2O6S — CID 136670891
3-[(4-ethenylphenyl)diazenyl]-2-hydroxy-5-sulfobenzoic acid (PubChem CID 136670891) has the molecular formula C15H12N2O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is 3-[(4-ethenylphenyl)diazenyl]-2-hydroxy-5-sulfobenzoic acid.
| Compound Name | 3-[(4-ethenylphenyl)diazenyl]-2-hydroxy-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 136670891 |
| Molecular Formula | C15H12N2O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-[(4-ethenylphenyl)diazenyl]-2-hydroxy-5-sulfobenzoic acid |
| SMILES | C=Cc1ccc(/N=N/c2cc(S(=O)(=O)O)cc(C(=O)O)c2O)cc1 |
| InChI | InChI=1S/C15H12N2O6S/c1-2-9-3-5-10(6-4-9)16-17-13-8-11(24(21,22)23)7-12(14(13)18)15(19)20/h2-8,18H,1H2,(H,19,20)(H,21,22,23)/b17-16+ |
| InChIKey | SXCPFCUACMQBRS-WUKNDPDISA-N |
| XLogP | 3.40 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|