C24H18N6O18S3 — CID 136708887
3-[[4,6-bis[(3-carboxy-2-hydroxy-5-sulfophenyl)imino]-1,3,5-triazinan-2-ylidene]amino]-2-hydroxy-5-sulfobenzoic acid (PubChem CID 136708887) has the molecular formula C24H18N6O18S3 and a molecular weight of 774.63 g/mol. Its IUPAC name is 3-[[4,6-bis[(3-carboxy-2-hydroxy-5-sulfophenyl)imino]-1,3,5-triazinan-2-ylidene]amino]-2-hydroxy-5-sulfobenzoic acid.
| Compound Name | 3-[[4,6-bis[(3-carboxy-2-hydroxy-5-sulfophenyl)imino]-1,3,5-triazinan-2-ylidene]amino]-2-hydroxy-5-sulfobenzoic acid |
|---|---|
| PubChem CID | 136708887 |
| Molecular Formula | C24H18N6O18S3 |
| Molecular Weight | 774.63 g/mol |
| Exact Mass | 773.98 |
| IUPAC Name | 3-[[4,6-bis[(3-carboxy-2-hydroxy-5-sulfophenyl)imino]-1,3,5-triazinan-2-ylidene]amino]-2-hydroxy-5-sulfobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)O)cc(N=c2[nH]c(=Nc3cc(S(=O)(=O)O)cc(C(=O)O)c3O)[nH]c(=Nc3cc(S(=O)(=O)O)cc(C(=O)O)c3O)[nH]2)c1O |
| InChI | InChI=1S/C24H18N6O18S3/c31-16-10(19(34)35)1-7(49(40,41)42)4-13(16)25-22-28-23(26-14-5-8(50(43,44)45)2-11(17(14)32)20(36)37)30-24(29-22)27-15-6-9(51(46,47)48)3-12(18(15)33)21(38)39/h1-6,31-33H,(H,34,35)(H,36,37)(H,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H3,25,26,27,28,29,30) |
| InChIKey | YLSMKTQVBIUBLQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 420.15 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.63 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|