C18H26O6S2 — CID 144520590
ethane;prop-1-ene;2,5,6-trimethylnaphthalene-1,7-disulfonic acid (PubChem CID 144520590) has the molecular formula C18H26O6S2 and a molecular weight of 402.53 g/mol. Its IUPAC name is ethane;prop-1-ene;2,5,6-trimethylnaphthalene-1,7-disulfonic acid.
| Compound Name | ethane;prop-1-ene;2,5,6-trimethylnaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 144520590 |
| Molecular Formula | C18H26O6S2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | ethane;prop-1-ene;2,5,6-trimethylnaphthalene-1,7-disulfonic acid |
| SMILES | C=CC.CC.Cc1ccc2c(C)c(C)c(S(=O)(=O)O)cc2c1S(=O)(=O)O |
| InChI | InChI=1S/C13H14O6S2.C3H6.C2H6/c1-7-4-5-10-8(2)9(3)12(20(14,15)16)6-11(10)13(7)21(17,18)19;1-3-2;1-2/h4-6H,1-3H3,(H,14,15,16)(H,17,18,19);3H,1H2,2H3;1-2H3 |
| InChIKey | OUAFKGAAJUFXDU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|