C48H36N6O6 — CID 59757248
tris(4-methyl-2-phenyldiazenylphenyl) benzene-1,3,5-tricarboxylate (PubChem CID 59757248) has the molecular formula C48H36N6O6 and a molecular weight of 792.85 g/mol. Its IUPAC name is tris(4-methyl-2-phenyldiazenylphenyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(4-methyl-2-phenyldiazenylphenyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59757248 |
| Molecular Formula | C48H36N6O6 |
| Molecular Weight | 792.85 g/mol |
| Exact Mass | 792.27 |
| IUPAC Name | tris(4-methyl-2-phenyldiazenylphenyl) benzene-1,3,5-tricarboxylate |
| SMILES | Cc1ccc(OC(=O)c2cc(C(=O)Oc3ccc(C)cc3/N=N/c3ccccc3)cc(C(=O)Oc3ccc(C)cc3/N=N/c3ccccc3)c2)c(/N=N/c2ccccc2)c1 |
| InChI | InChI=1S/C48H36N6O6/c1-31-19-22-43(40(25-31)52-49-37-13-7-4-8-14-37)58-46(55)34-28-35(47(56)59-44-23-20-32(2)26-41(44)53-50-38-15-9-5-10-16-38)30-36(29-34)48(57)60-45-24-21-33(3)27-42(45)54-51-39-17-11-6-12-18-39/h4-30H,1-3H3/b52-49+,53-50+,54-51+ |
| InChIKey | VSEUFRZOGRJYGA-WSUSHDEBSA-N |
| XLogP | 13.52 |
| TPSA | 153.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.85 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|