C17H16N2O4 — CID 163970914
dimethyl 4-methyl-5-phenyldiazenylbenzene-1,3-dicarboxylate (PubChem CID 163970914) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is dimethyl 4-methyl-5-phenyldiazenylbenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-methyl-5-phenyldiazenylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 163970914 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | dimethyl 4-methyl-5-phenyldiazenylbenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=N/c2ccccc2)c(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-11-14(17(21)23-3)9-12(16(20)22-2)10-15(11)19-18-13-7-5-4-6-8-13/h4-10H,1-3H3/b19-18+ |
| InChIKey | SPXNZWWYLSSLOK-VHEBQXMUSA-N |
| XLogP | 3.98 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|