C12H15NO3 — CID 117315602
methyl 5-(2-aminoacetyl)-2,3-dimethylbenzoate (PubChem CID 117315602) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 5-(2-aminoacetyl)-2,3-dimethylbenzoate.
| Compound Name | methyl 5-(2-aminoacetyl)-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 117315602 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl 5-(2-aminoacetyl)-2,3-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C(=O)CN)cc(C)c1C |
| InChI | InChI=1S/C12H15NO3/c1-7-4-9(11(14)6-13)5-10(8(7)2)12(15)16-3/h4-5H,6,13H2,1-3H3 |
| InChIKey | YFKHWUMNAZWWIU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |