About 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate
2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate (PubChem CID 160772754) has the molecular formula C18H19F2NO3
and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate.
Molecular Properties
| Compound Name | 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate |
| PubChem CID | 160772754 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(F)c1.Cc1ccc(C(=O)CN)cc1F |
| InChI | InChI=1S/C9H10FNO.C9H9FO2/c1-6-2-3-7(4-8(6)10)9(12)5-11;1-6-3-4-7(5-8(6)10)9(11)12-2/h2-4H,5,11H2,1H3;3-5H,1-2H3 |
| InChIKey | RZNOHRZNORNHLI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate?
The IUPAC name of 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate (CID 160772754) is 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate.
What is the SMILES notation for 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate?
The canonical SMILES for 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate is COC(=O)c1ccc(C)c(F)c1.Cc1ccc(C(=O)CN)cc1F.
What is the InChIKey of 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate?
The InChIKey is RZNOHRZNORNHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO.C9H9FO2/c1-6-2-3-7(4-8(6)10)9(12)5-11;1-6-3-4-7(5-8(6)10)9(11)12-2/h2-4H,5,11H2,1H3;3-5H,1-2H3.
What are the key properties of 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate?
2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate has a molecular weight of 335.35 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3-fluoro-4-methylphenyl)ethanone;methyl 3-fluoro-4-methylbenzoate is sourced from PubChem (CID 160772754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).