C12H17NO2 — CID 117295954
3-amino-1-(3-methoxy-4,5-dimethylphenyl)propan-1-one (PubChem CID 117295954) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-amino-1-(3-methoxy-4,5-dimethylphenyl)propan-1-one.
| Compound Name | 3-amino-1-(3-methoxy-4,5-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 117295954 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-amino-1-(3-methoxy-4,5-dimethylphenyl)propan-1-one |
| SMILES | COc1cc(C(=O)CCN)cc(C)c1C |
| InChI | InChI=1S/C12H17NO2/c1-8-6-10(11(14)4-5-13)7-12(15-3)9(8)2/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | LNKJTHMFDMUSDT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |