C21H14N4O — CID 168665528
4-(4-methyl-2-phenyldiazenylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 168665528) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-(4-methyl-2-phenyldiazenylphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-methyl-2-phenyldiazenylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 168665528 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-(4-methyl-2-phenyldiazenylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1ccc(Oc2ccc(C#N)c(C#N)c2)c(/N=N\c2ccccc2)c1 |
| InChI | InChI=1S/C21H14N4O/c1-15-7-10-21(20(11-15)25-24-18-5-3-2-4-6-18)26-19-9-8-16(13-22)17(12-19)14-23/h2-12H,1H3/b25-24- |
| InChIKey | XAVZVRFMTRWGLP-IZHYLOQSSA-N |
| XLogP | 5.95 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|