C24H23N5OS — CID 170908775
2-[[3-cyano-4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-pyridinyl]sulfanyl]-N-(4-methylphenyl)acetamide (PubChem CID 170908775) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-[[3-cyano-4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-pyridinyl]sulfanyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[3-cyano-4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-pyridinyl]sulfanyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 170908775 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[[3-cyano-4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-pyridinyl]sulfanyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(/N=N/c2c(C)nc(SCC(=O)Nc3ccc(C)cc3)c(C#N)c2C)cc1 |
| InChI | InChI=1S/C24H23N5OS/c1-15-5-9-19(10-6-15)27-22(30)14-31-24-21(13-25)17(3)23(18(4)26-24)29-28-20-11-7-16(2)8-12-20/h5-12H,14H2,1-4H3,(H,27,30)/b29-28+ |
| InChIKey | ABIJXZURHCYWNY-ZQHSETAFSA-N |
| XLogP | 6.33 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|