C30H47N4O2S+ — CID 155395095
[2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]methylsulfanyl]ethyl]-dipropylazanium (PubChem CID 155395095) has the molecular formula C30H47N4O2S+ and a molecular weight of 527.80 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]methylsulfanyl]ethyl]-dipropylazanium.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]methylsulfanyl]ethyl]-dipropylazanium |
|---|---|
| PubChem CID | 155395095 |
| Molecular Formula | C30H47N4O2S+ |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl]-[2-[[[2-(2,6-dimethylanilino)-2-oxoethyl]-methylamino]methylsulfanyl]ethyl]-dipropylazanium |
| SMILES | CCC[N+](CCC)(CCSCN(C)CC(=O)Nc1c(C)cccc1C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C30H46N4O2S/c1-8-16-34(17-9-2,21-28(36)32-30-25(5)14-11-15-26(30)6)18-19-37-22-33(7)20-27(35)31-29-23(3)12-10-13-24(29)4/h10-15H,8-9,16-22H2,1-7H3,(H-,31,32,35,36)/p+1 |
| InChIKey | KNROKTCFLNDKJJ-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|