C18H18ClN3O — CID 169368429
N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide (PubChem CID 169368429) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide.
| Compound Name | N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169368429 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide |
| SMILES | CC(=O)N1c2ccccc2CCc2ccc(/N=C(/N)CCl)cc21 |
| InChI | InChI=1S/C18H18ClN3O/c1-12(23)22-16-5-3-2-4-13(16)6-7-14-8-9-15(10-17(14)22)21-18(20)11-19/h2-5,8-10H,6-7,11H2,1H3,(H2,20,21) |
| InChIKey | LFZPZWYWHPFNHI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|