About N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide
N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide (PubChem CID 169368429) has the molecular formula C18H18ClN3O
and a molecular weight of 327.82 g/mol. Its IUPAC name is N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide.
Molecular Properties
| Compound Name | N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide |
| PubChem CID | 169368429 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide |
| SMILES | CC(=O)N1c2ccccc2CCc2ccc(/N=C(/N)CCl)cc21 |
| InChI | InChI=1S/C18H18ClN3O/c1-12(23)22-16-5-3-2-4-13(16)6-7-14-8-9-15(10-17(14)22)21-18(20)11-19/h2-5,8-10H,6-7,11H2,1H3,(H2,20,21) |
| InChIKey | LFZPZWYWHPFNHI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide?
The IUPAC name of N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide (CID 169368429) is N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide.
What is the SMILES notation for N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide?
The canonical SMILES for N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide is CC(=O)N1c2ccccc2CCc2ccc(/N=C(/N)CCl)cc21.
What is the InChIKey of N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide?
The InChIKey is LFZPZWYWHPFNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN3O/c1-12(23)22-16-5-3-2-4-13(16)6-7-14-8-9-15(10-17(14)22)21-18(20)11-19/h2-5,8-10H,6-7,11H2,1H3,(H2,20,21).
What are the key properties of N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide?
N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide has a molecular weight of 327.82 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)-2-chloroethanimidamide is sourced from PubChem (CID 169368429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).