C10H12ClN3 — CID 169367360
2-chloro-N'-(2,3-dihydro-1H-isoindol-5-yl)ethanimidamide (PubChem CID 169367360) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-chloro-N'-(2,3-dihydro-1H-isoindol-5-yl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,3-dihydro-1H-isoindol-5-yl)ethanimidamide |
|---|---|
| PubChem CID | 169367360 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-chloro-N'-(2,3-dihydro-1H-isoindol-5-yl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C10H12ClN3/c11-4-10(12)14-9-2-1-7-5-13-6-8(7)3-9/h1-3,13H,4-6H2,(H2,12,14) |
| InChIKey | VUICKNMEAFRUNI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|