About ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate
ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate (PubChem CID 110168366) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate |
| PubChem CID | 110168366 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(N)=O)c1ccccc1CC2 |
| InChI | InChI=1S/C18H19N3O3/c1-2-24-18(23)20-14-10-9-13-8-7-12-5-3-4-6-15(12)21(17(19)22)16(13)11-14/h3-6,9-11H,2,7-8H2,1H3,(H2,19,22)(H,20,23) |
| InChIKey | ODGMZLLWPKKEOW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate?
The IUPAC name of ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate (CID 110168366) is ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate.
What is the SMILES notation for ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate?
The canonical SMILES for ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate is CCOC(=O)Nc1ccc2c(c1)N(C(N)=O)c1ccccc1CC2.
What is the InChIKey of ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate?
The InChIKey is ODGMZLLWPKKEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3/c1-2-24-18(23)20-14-10-9-13-8-7-12-5-3-4-6-15(12)21(17(19)22)16(13)11-14/h3-6,9-11H,2,7-8H2,1H3,(H2,19,22)(H,20,23).
What are the key properties of ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate?
ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate has a molecular weight of 325.37 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)carbamate is sourced from PubChem (CID 110168366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).