C22H28ClN3O4 — CID 110169264
[3-[2-(ethoxycarbonylamino)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]-3-oxopropyl]-(2-hydroxyethyl)azanium chloride (PubChem CID 110169264) has the molecular formula C22H28ClN3O4 and a molecular weight of 433.94 g/mol. Its IUPAC name is [3-[2-(ethoxycarbonylamino)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]-3-oxopropyl]-(2-hydroxyethyl)azanium chloride.
| Compound Name | [3-[2-(ethoxycarbonylamino)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]-3-oxopropyl]-(2-hydroxyethyl)azanium chloride |
|---|---|
| PubChem CID | 110169264 |
| Molecular Formula | C22H28ClN3O4 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [3-[2-(ethoxycarbonylamino)-5,6-dihydrobenzo[b][1]benzazepin-11-yl]-3-oxopropyl]-(2-hydroxyethyl)azanium chloride |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CC[NH2+]CCO)c1ccccc1CC2.[Cl-] |
| InChI | InChI=1S/C22H27N3O4.ClH/c1-2-29-22(28)24-18-10-9-17-8-7-16-5-3-4-6-19(16)25(20(17)15-18)21(27)11-12-23-13-14-26;/h3-6,9-10,15,23,26H,2,7-8,11-14H2,1H3,(H,24,28);1H |
| InChIKey | JFDVOYJIJAVSHT-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|