C21H26ClN3O4 — CID 67877133
methyl N-[11-[3-(1-hydroxyethylamino)propanoyl]-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate;hydrochloride (PubChem CID 67877133) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl N-[11-[3-(1-hydroxyethylamino)propanoyl]-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate;hydrochloride.
| Compound Name | methyl N-[11-[3-(1-hydroxyethylamino)propanoyl]-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 67877133 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | methyl N-[11-[3-(1-hydroxyethylamino)propanoyl]-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate;hydrochloride |
| SMILES | COC(=O)Nc1ccc2c(c1)N(C(=O)CCNC(C)O)c1ccccc1CC2.Cl |
| InChI | InChI=1S/C21H25N3O4.ClH/c1-14(25)22-12-11-20(26)24-18-6-4-3-5-15(18)7-8-16-9-10-17(13-19(16)24)23-21(27)28-2;/h3-6,9-10,13-14,22,25H,7-8,11-12H2,1-2H3,(H,23,27);1H |
| InChIKey | ZLTMDITYZXMODN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|