C20H17N7O — CID 169345627
3-[(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345627) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-[(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345627 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-[(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC(=O)N1c2ccccc2CCc2ccc(NC=C(C#N)c3nn[nH]n3)cc21 |
| InChI | InChI=1S/C20H17N7O/c1-13(28)27-18-5-3-2-4-14(18)6-7-15-8-9-17(10-19(15)27)22-12-16(11-21)20-23-25-26-24-20/h2-5,8-10,12,22H,6-7H2,1H3,(H,23,24,25,26) |
| InChIKey | VBVCDAUUYHVBPR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|