C15H11ClN2O2 — CID 139449063
5-methyl-6-oxobenzo[b][1,4]benzodiazepine-11-carbonyl chloride (PubChem CID 139449063) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 5-methyl-6-oxobenzo[b][1,4]benzodiazepine-11-carbonyl chloride.
| Compound Name | 5-methyl-6-oxobenzo[b][1,4]benzodiazepine-11-carbonyl chloride |
|---|---|
| PubChem CID | 139449063 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-methyl-6-oxobenzo[b][1,4]benzodiazepine-11-carbonyl chloride |
| SMILES | CN1C(=O)c2ccccc2N(C(=O)Cl)c2ccccc21 |
| InChI | InChI=1S/C15H11ClN2O2/c1-17-12-8-4-5-9-13(12)18(15(16)20)11-7-3-2-6-10(11)14(17)19/h2-9H,1H3 |
| InChIKey | MIPXNMWKKLWORU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|