C19H17F3O3S — CID 162535874
(6,6,6-trifluoro-1-phenylhex-4-yn-3-yl) 4-methylbenzenesulfonate (PubChem CID 162535874) has the molecular formula C19H17F3O3S and a molecular weight of 382.40 g/mol. Its IUPAC name is (6,6,6-trifluoro-1-phenylhex-4-yn-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (6,6,6-trifluoro-1-phenylhex-4-yn-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162535874 |
| Molecular Formula | C19H17F3O3S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (6,6,6-trifluoro-1-phenylhex-4-yn-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C#CC(F)(F)F)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17F3O3S/c1-15-7-11-18(12-8-15)26(23,24)25-17(13-14-19(20,21)22)10-9-16-5-3-2-4-6-16/h2-8,11-12,17H,9-10H2,1H3 |
| InChIKey | CAGFIVSVHYGWHY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|