C19H20O3S — CID 138982909
1-phenylhex-4-yn-3-yl 4-methylbenzenesulfonate (PubChem CID 138982909) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-phenylhex-4-yn-3-yl 4-methylbenzenesulfonate.
| Compound Name | 1-phenylhex-4-yn-3-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138982909 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-phenylhex-4-yn-3-yl 4-methylbenzenesulfonate |
| SMILES | CC#CC(CCc1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-3-7-18(13-12-17-8-5-4-6-9-17)22-23(20,21)19-14-10-16(2)11-15-19/h4-6,8-11,14-15,18H,12-13H2,1-2H3 |
| InChIKey | VYFBPLBRSQEPHX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|