C13H12O4S — CID 139722368
1-hydroxyhexa-2,4-diynyl 4-methylbenzenesulfonate (PubChem CID 139722368) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-hydroxyhexa-2,4-diynyl 4-methylbenzenesulfonate.
| Compound Name | 1-hydroxyhexa-2,4-diynyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139722368 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-hydroxyhexa-2,4-diynyl 4-methylbenzenesulfonate |
| SMILES | CC#CC#CC(O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H12O4S/c1-3-4-5-6-13(14)17-18(15,16)12-9-7-11(2)8-10-12/h7-10,13-14H,1-2H3 |
| InChIKey | LMSAKJMXEKKFCA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|