C14H17F3O4S — CID 100987257
[(2R,3S)-1,1,1-trifluoro-3-hydroxy-5-methylhex-5-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 100987257) has the molecular formula C14H17F3O4S and a molecular weight of 338.35 g/mol. Its IUPAC name is [(2R,3S)-1,1,1-trifluoro-3-hydroxy-5-methylhex-5-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-1,1,1-trifluoro-3-hydroxy-5-methylhex-5-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100987257 |
| Molecular Formula | C14H17F3O4S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(2R,3S)-1,1,1-trifluoro-3-hydroxy-5-methylhex-5-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(C)C[C@H](O)[C@@H](OS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O4S/c1-9(2)8-12(18)13(14(15,16)17)21-22(19,20)11-6-4-10(3)5-7-11/h4-7,12-13,18H,1,8H2,2-3H3/t12-,13+/m0/s1 |
| InChIKey | LNNZTSMFANGXNR-QWHCGFSZSA-N |
| XLogP | 2.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|