C12H15F5O9S3 — CID 160630375
1,1,1,3,3-pentafluoropropan-2-yl 4-methylbenzenesulfonate;sulfo ethanesulfonate (PubChem CID 160630375) has the molecular formula C12H15F5O9S3 and a molecular weight of 494.43 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoropropan-2-yl 4-methylbenzenesulfonate;sulfo ethanesulfonate.
| Compound Name | 1,1,1,3,3-pentafluoropropan-2-yl 4-methylbenzenesulfonate;sulfo ethanesulfonate |
|---|---|
| PubChem CID | 160630375 |
| Molecular Formula | C12H15F5O9S3 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 1,1,1,3,3-pentafluoropropan-2-yl 4-methylbenzenesulfonate;sulfo ethanesulfonate |
| SMILES | CCS(=O)(=O)OS(=O)(=O)O.Cc1ccc(S(=O)(=O)OC(C(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F5O3S.C2H6O6S2/c1-6-2-4-7(5-3-6)19(16,17)18-8(9(11)12)10(13,14)15;1-2-9(3,4)8-10(5,6)7/h2-5,8-9H,1H3;2H2,1H3,(H,5,6,7) |
| InChIKey | RHVQXEXHSVRWKE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|