C15H22O4S — CID 118011189
(2-hydroxy-2,5-dimethylhex-5-en-3-yl) 4-methylbenzenesulfonate (PubChem CID 118011189) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is (2-hydroxy-2,5-dimethylhex-5-en-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-hydroxy-2,5-dimethylhex-5-en-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118011189 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2-hydroxy-2,5-dimethylhex-5-en-3-yl) 4-methylbenzenesulfonate |
| SMILES | C=C(C)CC(OS(=O)(=O)c1ccc(C)cc1)C(C)(C)O |
| InChI | InChI=1S/C15H22O4S/c1-11(2)10-14(15(4,5)16)19-20(17,18)13-8-6-12(3)7-9-13/h6-9,14,16H,1,10H2,2-5H3 |
| InChIKey | LOYYHNROWJTMGZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|