C12H20ClN3O — CID 19476881
4-chloro-N-hexyl-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19476881) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-chloro-N-hexyl-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-hexyl-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476881 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-chloro-N-hexyl-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C12H20ClN3O/c1-4-5-6-7-8-14-12(17)11-10(13)9(2)15-16(11)3/h4-8H2,1-3H3,(H,14,17) |
| InChIKey | YYGFSWOCEQYLMI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|