C17H18ClF4N3OS — CID 19433076
N-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methyl]-4-chloro-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19433076) has the molecular formula C17H18ClF4N3OS and a molecular weight of 423.86 g/mol. Its IUPAC name is N-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methyl]-4-chloro-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | N-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methyl]-4-chloro-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19433076 |
| Molecular Formula | C17H18ClF4N3OS |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methyl]-4-chloro-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | CCCCSc1c(F)c(F)c(CNC(=O)c2c(Cl)c(C)nn2C)c(F)c1F |
| InChI | InChI=1S/C17H18ClF4N3OS/c1-4-5-6-27-16-13(21)11(19)9(12(20)14(16)22)7-23-17(26)15-10(18)8(2)24-25(15)3/h4-7H2,1-3H3,(H,23,26) |
| InChIKey | QOUKEPSGHKREPD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|