C20H28ClN3O — CID 14460836
4-chloro-3-ethyl-N-[(4-hexylphenyl)methyl]-1-methylpyrazole-5-carboxamide (PubChem CID 14460836) has the molecular formula C20H28ClN3O and a molecular weight of 361.92 g/mol. Its IUPAC name is 4-chloro-3-ethyl-N-[(4-hexylphenyl)methyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-3-ethyl-N-[(4-hexylphenyl)methyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 14460836 |
| Molecular Formula | C20H28ClN3O |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-chloro-3-ethyl-N-[(4-hexylphenyl)methyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCCCCCc1ccc(CNC(=O)c2c(Cl)c(CC)nn2C)cc1 |
| InChI | InChI=1S/C20H28ClN3O/c1-4-6-7-8-9-15-10-12-16(13-11-15)14-22-20(25)19-18(21)17(5-2)23-24(19)3/h10-13H,4-9,14H2,1-3H3,(H,22,25) |
| InChIKey | VEDAMWRILVNILN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|