C22H31ClN2O — CID 167119871
N-[(4-chlorophenyl)methyl]-2,5-diethyl-1-methyl-4-pentylpyrrole-3-carboxamide (PubChem CID 167119871) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2,5-diethyl-1-methyl-4-pentylpyrrole-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2,5-diethyl-1-methyl-4-pentylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 167119871 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2,5-diethyl-1-methyl-4-pentylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(C(=O)NCc2ccc(Cl)cc2)c(CC)n(C)c1CC |
| InChI | InChI=1S/C22H31ClN2O/c1-5-8-9-10-18-19(6-2)25(4)20(7-3)21(18)22(26)24-15-16-11-13-17(23)14-12-16/h11-14H,5-10,15H2,1-4H3,(H,24,26) |
| InChIKey | NCRKKUWDNINCCJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|