C29H31ClN2O4 — CID 10239251
2-[(4-chlorophenyl)methyl-[[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-oxoacetic acid (PubChem CID 10239251) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl-[[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 10239251 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]methyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCc1ccc(CNC(=O)c2cccc(CN(Cc3ccc(Cl)cc3)C(=O)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C29H31ClN2O4/c1-2-3-4-6-21-9-11-22(12-10-21)18-31-27(33)25-8-5-7-24(17-25)20-32(28(34)29(35)36)19-23-13-15-26(30)16-14-23/h5,7-17H,2-4,6,18-20H2,1H3,(H,31,33)(H,35,36) |
| InChIKey | JXSHGQOIJNUABV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|