C21H25F4N3O — CID 19433071
2,6-dimethyl-N-[(2,3,5,6-tetrafluoro-4-pentylphenyl)methyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxamide (PubChem CID 19433071) has the molecular formula C21H25F4N3O and a molecular weight of 411.44 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(2,3,5,6-tetrafluoro-4-pentylphenyl)methyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxamide.
| Compound Name | 2,6-dimethyl-N-[(2,3,5,6-tetrafluoro-4-pentylphenyl)methyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19433071 |
| Molecular Formula | C21H25F4N3O |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2,6-dimethyl-N-[(2,3,5,6-tetrafluoro-4-pentylphenyl)methyl]-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxamide |
| SMILES | CCCCCc1c(F)c(F)c(CNC(=O)c2c3c(nn2C)C(C)CC3)c(F)c1F |
| InChI | InChI=1S/C21H25F4N3O/c1-4-5-6-7-12-15(22)17(24)14(18(25)16(12)23)10-26-21(29)20-13-9-8-11(2)19(13)27-28(20)3/h11H,4-10H2,1-3H3,(H,26,29) |
| InChIKey | MSZZRKIGRNITNJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|