C20H24FN3O2 — CID 146093400
(5R,7S)-N-[(4-cyclopropyl-2-fluorophenyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146093400) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is (5R,7S)-N-[(4-cyclopropyl-2-fluorophenyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[(4-cyclopropyl-2-fluorophenyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146093400 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (5R,7S)-N-[(4-cyclopropyl-2-fluorophenyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)NCc2ccc(C3CC3)cc2F)[C@H](C)O1 |
| InChI | InChI=1S/C20H24FN3O2/c1-11-8-16-18(12(2)26-11)23-24(3)19(16)20(25)22-10-15-7-6-14(9-17(15)21)13-4-5-13/h6-7,9,11-13H,4-5,8,10H2,1-3H3,(H,22,25)/t11-,12+/m1/s1 |
| InChIKey | JEXJPGXFTYQBPX-NEPJUHHUSA-N |
| XLogP | 3.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |