C17H19N5O2 — CID 146100517
(5R,7S)-N-[(5-cyano-3-pyridinyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146100517) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (5R,7S)-N-[(5-cyano-3-pyridinyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[(5-cyano-3-pyridinyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146100517 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (5R,7S)-N-[(5-cyano-3-pyridinyl)methyl]-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)NCc2cncc(C#N)c2)[C@H](C)O1 |
| InChI | InChI=1S/C17H19N5O2/c1-10-4-14-15(11(2)24-10)21-22(3)16(14)17(23)20-9-13-5-12(6-18)7-19-8-13/h5,7-8,10-11H,4,9H2,1-3H3,(H,20,23)/t10-,11+/m1/s1 |
| InChIKey | WWEZACUQJJOXTP-MNOVXSKESA-N |
| XLogP | 1.64 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |