C19H25N3O4S — CID 146093487
(5R,7S)-2,5,7-trimethyl-N-[[2-(methylsulfonylmethyl)phenyl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146093487) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (5R,7S)-2,5,7-trimethyl-N-[[2-(methylsulfonylmethyl)phenyl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-2,5,7-trimethyl-N-[[2-(methylsulfonylmethyl)phenyl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146093487 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (5R,7S)-2,5,7-trimethyl-N-[[2-(methylsulfonylmethyl)phenyl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)NCc2ccccc2CS(C)(=O)=O)[C@H](C)O1 |
| InChI | InChI=1S/C19H25N3O4S/c1-12-9-16-17(13(2)26-12)21-22(3)18(16)19(23)20-10-14-7-5-6-8-15(14)11-27(4,24)25/h5-8,12-13H,9-11H2,1-4H3,(H,20,23)/t12-,13+/m1/s1 |
| InChIKey | GNFDDEGFUHEAFY-OLZOCXBDSA-N |
| XLogP | 1.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |