C17H16ClF4N3O2 — CID 19433080
4-chloro-N-[[4-(cyclopropylmethoxy)-2,3,5,6-tetrafluorophenyl]methyl]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19433080) has the molecular formula C17H16ClF4N3O2 and a molecular weight of 405.78 g/mol. Its IUPAC name is 4-chloro-N-[[4-(cyclopropylmethoxy)-2,3,5,6-tetrafluorophenyl]methyl]-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[[4-(cyclopropylmethoxy)-2,3,5,6-tetrafluorophenyl]methyl]-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19433080 |
| Molecular Formula | C17H16ClF4N3O2 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-chloro-N-[[4-(cyclopropylmethoxy)-2,3,5,6-tetrafluorophenyl]methyl]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NCc2c(F)c(F)c(OCC3CC3)c(F)c2F)c1Cl |
| InChI | InChI=1S/C17H16ClF4N3O2/c1-7-10(18)15(25(2)24-7)17(26)23-5-9-11(19)13(21)16(14(22)12(9)20)27-6-8-3-4-8/h8H,3-6H2,1-2H3,(H,23,26) |
| InChIKey | IKBZUPYDTZUCLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|