C11H18ClN3O2 — CID 19477120
4-chloro-N-(3-ethoxypropyl)-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19477120) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 4-chloro-N-(3-ethoxypropyl)-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(3-ethoxypropyl)-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19477120 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-chloro-N-(3-ethoxypropyl)-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | CCOCCCNC(=O)c1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C11H18ClN3O2/c1-4-17-7-5-6-13-11(16)10-9(12)8(2)14-15(10)3/h4-7H2,1-3H3,(H,13,16) |
| InChIKey | YSMMFRVUKYTVGR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|