C16H12ClF4N5O — CID 19476990
4-chloro-1,3-dimethyl-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]pyrazole-5-carboxamide (PubChem CID 19476990) has the molecular formula C16H12ClF4N5O and a molecular weight of 401.75 g/mol. Its IUPAC name is 4-chloro-1,3-dimethyl-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1,3-dimethyl-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476990 |
| Molecular Formula | C16H12ClF4N5O |
| Molecular Weight | 401.75 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-chloro-1,3-dimethyl-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2cnn(Cc3c(F)cc(F)c(F)c3F)c2)c1Cl |
| InChI | InChI=1S/C16H12ClF4N5O/c1-7-12(17)15(25(2)24-7)16(27)23-8-4-22-26(5-8)6-9-10(18)3-11(19)14(21)13(9)20/h3-5H,6H2,1-2H3,(H,23,27) |
| InChIKey | UEWKUWZCABLGBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|