C17H12ClF6N5O — CID 19517511
2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]acetamide (PubChem CID 19517511) has the molecular formula C17H12ClF6N5O and a molecular weight of 451.76 g/mol. Its IUPAC name is 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]acetamide.
| Compound Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19517511 |
| Molecular Formula | C17H12ClF6N5O |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1c(Cl)c(C(F)F)nn1CC(=O)Nc1cnn(Cc2c(F)cc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H12ClF6N5O/c1-7-13(18)16(17(23)24)27-29(7)6-12(30)26-8-3-25-28(4-8)5-9-10(19)2-11(20)15(22)14(9)21/h2-4,17H,5-6H2,1H3,(H,26,30) |
| InChIKey | CLUQBYLBNVGOPC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|