C25H18ClF4N3O2 — CID 19406404
4-[(2-chloro-5-methylphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19406404) has the molecular formula C25H18ClF4N3O2 and a molecular weight of 503.88 g/mol. Its IUPAC name is 4-[(2-chloro-5-methylphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 4-[(2-chloro-5-methylphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19406404 |
| Molecular Formula | C25H18ClF4N3O2 |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 4-[(2-chloro-5-methylphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | Cc1ccc(Cl)c(OCc2ccc(C(=O)Nc3cnn(Cc4c(F)cc(F)c(F)c4F)c3)cc2)c1 |
| InChI | InChI=1S/C25H18ClF4N3O2/c1-14-2-7-19(26)22(8-14)35-13-15-3-5-16(6-4-15)25(34)32-17-10-31-33(11-17)12-18-20(27)9-21(28)24(30)23(18)29/h2-11H,12-13H2,1H3,(H,32,34) |
| InChIKey | VYLHYRMQENUNNH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|