C26H21F4N3O3 — CID 19406354
3-[(4-ethoxyphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19406354) has the molecular formula C26H21F4N3O3 and a molecular weight of 499.46 g/mol. Its IUPAC name is 3-[(4-ethoxyphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3-[(4-ethoxyphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19406354 |
| Molecular Formula | C26H21F4N3O3 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 3-[(4-ethoxyphenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | CCOc1ccc(OCc2cccc(C(=O)Nc3cnn(Cc4c(F)cc(F)c(F)c4F)c3)c2)cc1 |
| InChI | InChI=1S/C26H21F4N3O3/c1-2-35-19-6-8-20(9-7-19)36-15-16-4-3-5-17(10-16)26(34)32-18-12-31-33(13-18)14-21-22(27)11-23(28)25(30)24(21)29/h3-13H,2,14-15H2,1H3,(H,32,34) |
| InChIKey | ZMXHKYSBPPQMIT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|