C19H15F4N3O3 — CID 19408001
3,4-dimethoxy-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19408001) has the molecular formula C19H15F4N3O3 and a molecular weight of 409.34 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19408001 |
| Molecular Formula | C19H15F4N3O3 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3,4-dimethoxy-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cnn(Cc3c(F)cc(F)c(F)c3F)c2)cc1OC |
| InChI | InChI=1S/C19H15F4N3O3/c1-28-15-4-3-10(5-16(15)29-2)19(27)25-11-7-24-26(8-11)9-12-13(20)6-14(21)18(23)17(12)22/h3-8H,9H2,1-2H3,(H,25,27) |
| InChIKey | RJBWYOCGCFPYED-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|