C22H13BrClF4N3O3 — CID 19406407
5-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19406407) has the molecular formula C22H13BrClF4N3O3 and a molecular weight of 558.71 g/mol. Its IUPAC name is 5-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19406407 |
| Molecular Formula | C22H13BrClF4N3O3 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 556.98 |
| IUPAC Name | 5-[(4-bromo-2-chlorophenoxy)methyl]-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2c(F)cc(F)c(F)c2F)c1)c1ccc(COc2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C22H13BrClF4N3O3/c23-11-1-3-18(15(24)5-11)33-10-13-2-4-19(34-13)22(32)30-12-7-29-31(8-12)9-14-16(25)6-17(26)21(28)20(14)27/h1-8H,9-10H2,(H,30,32) |
| InChIKey | FGLWSQDAVVUUSF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|