C15H26ClN3 — CID 102641349
N-tert-butyl-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-amine (PubChem CID 102641349) has the molecular formula C15H26ClN3 and a molecular weight of 283.85 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-amine.
| Compound Name | N-tert-butyl-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102641349 |
| Molecular Formula | C15H26ClN3 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-tert-butyl-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-methylbut-3-en-1-amine |
| SMILES | C=CC(C)(CNC(C)(C)C)Cc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C15H26ClN3/c1-8-15(6,10-17-14(3,4)5)9-12-13(16)11(2)18-19(12)7/h8,17H,1,9-10H2,2-7H3 |
| InChIKey | VKTIZUVKIWWMEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|