C13H22Cl2N2 — CID 83143178
4-chloro-5-[2-(chloromethyl)-3,3-dimethylbutyl]-3-ethyl-1-methylpyrazole (PubChem CID 83143178) has the molecular formula C13H22Cl2N2 and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-chloro-5-[2-(chloromethyl)-3,3-dimethylbutyl]-3-ethyl-1-methylpyrazole.
| Compound Name | 4-chloro-5-[2-(chloromethyl)-3,3-dimethylbutyl]-3-ethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 83143178 |
| Molecular Formula | C13H22Cl2N2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-chloro-5-[2-(chloromethyl)-3,3-dimethylbutyl]-3-ethyl-1-methylpyrazole |
| SMILES | CCc1nn(C)c(CC(CCl)C(C)(C)C)c1Cl |
| InChI | InChI=1S/C13H22Cl2N2/c1-6-10-12(15)11(17(5)16-10)7-9(8-14)13(2,3)4/h9H,6-8H2,1-5H3 |
| InChIKey | NHDFQPCGRVCXRV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|